When 2,2,3,3-tetramethylpentane reacts with Cl2, how many monochlorocompounds can be obtained? Seek a detailed explanation.

Simple structural formula CH3C(CH3)2C(CH3)2CH2CH3

You see, there are two methyl groups on the second carbon atom. If the chlorine atom is replaced by either of these two methyl groups,

CH3C(CH3)(CH2Cl)C(CH3)2CH2CH3 or CH3C(CH2Cl)(CH3)C(CH3)2CH2CH3.

Structurally, if this carbon chain is facing you, one end is in front and the other end is facing your eyes,

The two branched methyl groups, whether the left one is substituted by hydrogen or the right one, rotate the carbon chain by 180 degrees.

These two situations are consistent. This is hydrogen with the same chemical environment.

So by extension:

We have CH2ClC(CH3)2C(CH3)2CH2CH3.

CH3C(CH3)(CH2Cl)C(CH3)2CH2CH3

CH3C(CH3)2C(CH3)(CH2Cl)CH2CH3

CH3C(CH3)2C(CH3)2CHClCH3

CH3C(CH3)2C(CH3)

Five kinds.